C18H15Cl2NO5 — CID 172990334
2-(2-hydroxyethoxy)ethyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 172990334) has the molecular formula C18H15Cl2NO5 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 172990334 |
| Molecular Formula | C18H15Cl2NO5 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCCOCCO)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C18H15Cl2NO5/c19-13-7-12(8-14(20)10-13)17-21-15-2-1-11(9-16(15)26-17)18(23)25-6-5-24-4-3-22/h1-2,7-10,22H,3-6H2 |
| InChIKey | XHWRERBZAPSRHP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|