C22H23Cl2NO3 — CID 166681589
octan-4-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 166681589) has the molecular formula C22H23Cl2NO3 and a molecular weight of 420.34 g/mol. Its IUPAC name is octan-4-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | octan-4-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 166681589 |
| Molecular Formula | C22H23Cl2NO3 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | octan-4-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | CCCCC(CCC)OC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C22H23Cl2NO3/c1-3-5-7-18(6-4-2)27-22(26)14-8-9-19-20(12-14)28-21(25-19)15-10-16(23)13-17(24)11-15/h8-13,18H,3-7H2,1-2H3 |
| InChIKey | RLMCBXONCZEHFL-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |