C23H27Cl2NO4Si — CID 171722808
1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 171722808) has the molecular formula C23H27Cl2NO4Si and a molecular weight of 480.46 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 171722808 |
| Molecular Formula | C23H27Cl2NO4Si |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)OC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C23H27Cl2NO4Si/c1-14(13-28-31(5,6)23(2,3)4)29-22(27)15-7-8-19-20(11-15)30-21(26-19)16-9-17(24)12-18(25)10-16/h7-12,14H,13H2,1-6H3 |
| InChIKey | RWYLPCOFUKCADH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|