About [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 167448306) has the molecular formula C24H27Cl2NO4Si
and a molecular weight of 492.48 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
Molecular Properties
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| PubChem CID | 167448306 |
| Molecular Formula | C24H27Cl2NO4Si |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(OC(=O)c2ccc3nc(-c4cc(Cl)cc(Cl)c4)oc3c2)C1 |
| InChI | InChI=1S/C24H27Cl2NO4Si/c1-24(2,3)32(4,5)31-19-12-18(13-19)29-23(28)14-6-7-20-21(10-14)30-22(27-20)15-8-16(25)11-17(26)9-15/h6-11,18-19H,12-13H2,1-5H3 |
| InChIKey | WFEKESHFBIGIJW-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate?
The IUPAC name of [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (CID 167448306) is [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
What is the SMILES notation for [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate?
The canonical SMILES for [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate is CC(C)(C)[Si](C)(C)OC1CC(OC(=O)c2ccc3nc(-c4cc(Cl)cc(Cl)c4)oc3c2)C1.
What is the InChIKey of [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate?
The InChIKey is WFEKESHFBIGIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27Cl2NO4Si/c1-24(2,3)32(4,5)31-19-12-18(13-19)29-23(28)14-6-7-20-21(10-14)30-22(27-20)15-8-16(25)11-17(26)9-15/h6-11,18-19H,12-13H2,1-5H3.
What are the key properties of [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate?
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate has a molecular weight of 492.48 g/mol, XLogP of 7.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate is sourced from PubChem (CID 167448306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).