C14H8Cl2N2O2 — CID 167448203
2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 167448203) has the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 167448203 |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C14H8Cl2N2O2/c15-9-3-8(4-10(16)6-9)14-18-11-2-1-7(13(17)19)5-12(11)20-14/h1-6H,(H2,17,19) |
| InChIKey | GTTKSRXSBFLZFD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |