C14H10N2O2 — CID 21105138
3-(1,3-benzoxazol-2-yl)benzamide (PubChem CID 21105138) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)benzamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 21105138 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C14H10N2O2/c15-13(17)9-4-3-5-10(8-9)14-16-11-6-1-2-7-12(11)18-14/h1-8H,(H2,15,17) |
| InChIKey | PJHMKFSGKGBSFS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |