C21H22Cl2N2O7 — CID 172763105
[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-yl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 172763105) has the molecular formula C21H22Cl2N2O7 and a molecular weight of 485.32 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-yl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-yl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 172763105 |
| Molecular Formula | C21H22Cl2N2O7 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-yl] 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | CNC[C@H](OC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H22Cl2N2O7/c1-24-8-17(19(29)18(28)15(27)9-26)32-21(30)10-2-3-14-16(6-10)31-20(25-14)11-4-12(22)7-13(23)5-11/h2-7,15,17-19,24,26-29H,8-9H2,1H3/t15-,17+,18-,19-/m1/s1 |
| InChIKey | LYMYCWASYRWFBQ-QXCFHYIPSA-N |
| XLogP | 1.62 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |