C22H21NO4S — CID 55755928
3-pyridin-3-ylpropyl 4-(benzenesulfonylmethyl)benzoate (PubChem CID 55755928) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 4-(benzenesulfonylmethyl)benzoate.
| Compound Name | 3-pyridin-3-ylpropyl 4-(benzenesulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 55755928 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-pyridin-3-ylpropyl 4-(benzenesulfonylmethyl)benzoate |
| SMILES | O=C(OCCCc1cccnc1)c1ccc(CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO4S/c24-22(27-15-5-7-18-6-4-14-23-16-18)20-12-10-19(11-13-20)17-28(25,26)21-8-2-1-3-9-21/h1-4,6,8-14,16H,5,7,15,17H2 |
| InChIKey | ALENBUCVORHNTC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|