C29H26FNO6S — CID 162070384
4-pyridin-3-ylbutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 162070384) has the molecular formula C29H26FNO6S and a molecular weight of 535.59 g/mol. Its IUPAC name is 4-pyridin-3-ylbutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 4-pyridin-3-ylbutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 162070384 |
| Molecular Formula | C29H26FNO6S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 4-pyridin-3-ylbutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | O=C(OCCCCc1cccnc1)c1ccc(CS(=O)(=O)c2cccc(-c3cc(F)ccc3O)c2)cc1O |
| InChI | InChI=1S/C29H26FNO6S/c30-23-10-12-27(32)26(17-23)22-7-3-8-24(16-22)38(35,36)19-21-9-11-25(28(33)15-21)29(34)37-14-2-1-5-20-6-4-13-31-18-20/h3-4,6-13,15-18,32-33H,1-2,5,14,19H2 |
| InChIKey | ZAZQHEVRRPGTBO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|