C28H25NO3S — CID 147366026
1-[4-[(2-phenylphenyl)methylsulfonyl]phenyl]-4-pyridin-3-ylbutan-2-one (PubChem CID 147366026) has the molecular formula C28H25NO3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[4-[(2-phenylphenyl)methylsulfonyl]phenyl]-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-[4-[(2-phenylphenyl)methylsulfonyl]phenyl]-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 147366026 |
| Molecular Formula | C28H25NO3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 1-[4-[(2-phenylphenyl)methylsulfonyl]phenyl]-4-pyridin-3-ylbutan-2-one |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(S(=O)(=O)Cc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO3S/c30-26(15-12-23-7-6-18-29-20-23)19-22-13-16-27(17-14-22)33(31,32)21-25-10-4-5-11-28(25)24-8-2-1-3-9-24/h1-11,13-14,16-18,20H,12,15,19,21H2 |
| InChIKey | DIEISUXEGFHKIP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |