C28H25NO2S — CID 160725556
1-[4-[(2-phenylphenyl)sulfinylmethyl]phenyl]-4-pyridin-3-ylbutan-2-one (PubChem CID 160725556) has the molecular formula C28H25NO2S and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-[4-[(2-phenylphenyl)sulfinylmethyl]phenyl]-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-[4-[(2-phenylphenyl)sulfinylmethyl]phenyl]-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 160725556 |
| Molecular Formula | C28H25NO2S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[4-[(2-phenylphenyl)sulfinylmethyl]phenyl]-4-pyridin-3-ylbutan-2-one |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(CS(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO2S/c30-26(17-16-23-7-6-18-29-20-23)19-22-12-14-24(15-13-22)21-32(31)28-11-5-4-10-27(28)25-8-2-1-3-9-25/h1-15,18,20H,16-17,19,21H2 |
| InChIKey | RTQVMJUFURNURP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |