C28H27N3O4S — CID 158306733
3-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfinamoylphenyl]benzamide;hydrate (PubChem CID 158306733) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is 3-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfinamoylphenyl]benzamide;hydrate.
| Compound Name | 3-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfinamoylphenyl]benzamide;hydrate |
|---|---|
| PubChem CID | 158306733 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfinamoylphenyl]benzamide;hydrate |
| SMILES | NC(=O)c1cccc(-c2ccccc2S(=O)Nc2ccc(CC(=O)CCc3cccnc3)cc2)c1.O |
| InChI | InChI=1S/C28H25N3O3S.H2O/c29-28(33)23-7-3-6-22(18-23)26-8-1-2-9-27(26)35(34)31-24-13-10-20(11-14-24)17-25(32)15-12-21-5-4-16-30-19-21;/h1-11,13-14,16,18-19,31H,12,15,17H2,(H2,29,33);1H2 |
| InChIKey | VSZPQCMBBQVYPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |