C21H21BrN2O3S — CID 160710505
3-bromo-N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]benzenesulfinamide;hydrate (PubChem CID 160710505) has the molecular formula C21H21BrN2O3S and a molecular weight of 461.38 g/mol. Its IUPAC name is 3-bromo-N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]benzenesulfinamide;hydrate.
| Compound Name | 3-bromo-N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]benzenesulfinamide;hydrate |
|---|---|
| PubChem CID | 160710505 |
| Molecular Formula | C21H21BrN2O3S |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 3-bromo-N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]benzenesulfinamide;hydrate |
| SMILES | O.O=C(CCc1cccnc1)Cc1ccc(NS(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H19BrN2O2S.H2O/c22-18-4-1-5-21(14-18)27(26)24-19-9-6-16(7-10-19)13-20(25)11-8-17-3-2-12-23-15-17;/h1-7,9-10,12,14-15,24H,8,11,13H2;1H2 |
| InChIKey | LSBJUZITEVZHAR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |