C22H21F3N2O4S — CID 158722777
N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]-2-(trifluoromethoxy)benzenesulfinamide;hydrate (PubChem CID 158722777) has the molecular formula C22H21F3N2O4S and a molecular weight of 466.48 g/mol. Its IUPAC name is N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]-2-(trifluoromethoxy)benzenesulfinamide;hydrate.
| Compound Name | N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]-2-(trifluoromethoxy)benzenesulfinamide;hydrate |
|---|---|
| PubChem CID | 158722777 |
| Molecular Formula | C22H21F3N2O4S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]-2-(trifluoromethoxy)benzenesulfinamide;hydrate |
| SMILES | O.O=C(CCc1cccnc1)Cc1ccc(NS(=O)c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3N2O3S.H2O/c23-22(24,25)30-20-5-1-2-6-21(20)31(29)27-18-10-7-16(8-11-18)14-19(28)12-9-17-4-3-13-26-15-17;/h1-8,10-11,13,15,27H,9,12,14H2;1H2 |
| InChIKey | HWMKYLYAEHFSQK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |