C30H27NO4 — CID 149033960
3-[2-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenoxy]ethyl]phenyl]benzoic acid (PubChem CID 149033960) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[2-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenoxy]ethyl]phenyl]benzoic acid.
| Compound Name | 3-[2-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenoxy]ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 149033960 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-[2-[2-[4-(2-oxo-4-pyridin-3-ylbutyl)phenoxy]ethyl]phenyl]benzoic acid |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(OCCc2ccccc2-c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C30H27NO4/c32-27(13-10-23-5-4-17-31-21-23)19-22-11-14-28(15-12-22)35-18-16-24-6-1-2-9-29(24)25-7-3-8-26(20-25)30(33)34/h1-9,11-12,14-15,17,20-21H,10,13,16,18-19H2,(H,33,34) |
| InChIKey | QGGOLEQAEDEJTF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |