C29H27NO4S — CID 147923950
1-[4-[[2-(4-methylsulfonylphenyl)phenoxy]methyl]phenyl]-4-pyridin-3-ylbutan-2-one (PubChem CID 147923950) has the molecular formula C29H27NO4S and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-[4-[[2-(4-methylsulfonylphenyl)phenoxy]methyl]phenyl]-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-[4-[[2-(4-methylsulfonylphenyl)phenoxy]methyl]phenyl]-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 147923950 |
| Molecular Formula | C29H27NO4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-[4-[[2-(4-methylsulfonylphenyl)phenoxy]methyl]phenyl]-4-pyridin-3-ylbutan-2-one |
| SMILES | CS(=O)(=O)c1ccc(-c2ccccc2OCc2ccc(CC(=O)CCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C29H27NO4S/c1-35(32,33)27-16-13-25(14-17-27)28-6-2-3-7-29(28)34-21-24-10-8-22(9-11-24)19-26(31)15-12-23-5-4-18-30-20-23/h2-11,13-14,16-18,20H,12,15,19,21H2,1H3 |
| InChIKey | IIOJUDXTAHNAOK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |