C23H24N2O4S — CID 78835869
3-pyridin-3-ylpropyl 3-(1-phenylethylsulfamoyl)benzoate (PubChem CID 78835869) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 3-(1-phenylethylsulfamoyl)benzoate.
| Compound Name | 3-pyridin-3-ylpropyl 3-(1-phenylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 78835869 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 3-pyridin-3-ylpropyl 3-(1-phenylethylsulfamoyl)benzoate |
| SMILES | CC(NS(=O)(=O)c1cccc(C(=O)OCCCc2cccnc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-18(20-10-3-2-4-11-20)25-30(27,28)22-13-5-12-21(16-22)23(26)29-15-7-9-19-8-6-14-24-17-19/h2-6,8,10-14,16-18,25H,7,9,15H2,1H3 |
| InChIKey | DSNSFSMRUNARFZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|