C21H20N2O5S — CID 42902900
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-(1-phenylethylsulfamoyl)benzoate (PubChem CID 42902900) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-(1-phenylethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-(1-phenylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42902900 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-(1-phenylethylsulfamoyl)benzoate |
| SMILES | CC(NS(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc[nH]2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-15(16-7-3-2-4-8-16)23-29(26,27)18-10-5-9-17(13-18)21(25)28-14-20(24)19-11-6-12-22-19/h2-13,15,22-23H,14H2,1H3 |
| InChIKey | UWXOYKMDUPHGAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |