C24H24N2O4S — CID 55333601
3-pyridin-3-ylpropyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 55333601) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | 3-pyridin-3-ylpropyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55333601 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-pyridin-3-ylpropyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCCCc1cccnc1)c1cccc(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C24H24N2O4S/c27-24(30-16-6-8-19-7-4-14-25-18-19)21-10-3-12-22(17-21)31(28,29)26-15-5-11-20-9-1-2-13-23(20)26/h1-4,7,9-10,12-14,17-18H,5-6,8,11,15-16H2 |
| InChIKey | UKFMHBBNBWBYCF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|