C22H23NO5S — CID 8663385
[(1R)-2-oxocyclohexyl] 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 8663385) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | [(1R)-2-oxocyclohexyl] 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 8663385 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(O[C@@H]1CCCCC1=O)c1cccc(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C22H23NO5S/c24-20-12-3-4-13-21(20)28-22(25)17-8-5-10-18(15-17)29(26,27)23-14-6-9-16-7-1-2-11-19(16)23/h1-2,5,7-8,10-11,15,21H,3-4,6,9,12-14H2/t21-/m1/s1 |
| InChIKey | TXVHLAVRSGADON-OAQYLSRUSA-N |
| XLogP | 3.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |