C20H21NO5S — CID 2380279
[(1S)-2-oxocyclohexyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 2380279) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [(1S)-2-oxocyclohexyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2380279 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | O=C(O[C@H]1CCCCC1=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H21NO5S/c22-18-11-4-5-12-19(18)26-20(23)16-9-6-10-17(13-16)27(24,25)21-14-15-7-2-1-3-8-15/h1-3,6-10,13,19,21H,4-5,11-12,14H2/t19-/m0/s1 |
| InChIKey | XBINXVXVLKRVNM-IBGZPJMESA-N |
| XLogP | 2.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |