C21H23NO5S — CID 9273491
[(1S)-2-oxocyclohexyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 9273491) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [(1S)-2-oxocyclohexyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 9273491 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)O[C@H]3CCCCC3=O)c2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-15-10-12-17(13-11-15)22(2)28(25,26)18-7-5-6-16(14-18)21(24)27-20-9-4-3-8-19(20)23/h5-7,10-14,20H,3-4,8-9H2,1-2H3/t20-/m0/s1 |
| InChIKey | BBUFUCVFXAMYTR-FQEVSTJZSA-N |
| XLogP | 3.49 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |