C24H30N2O5S — CID 2604741
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 2604741) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2604741 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)OCC(=O)N(C)C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24H30N2O5S/c1-18-12-14-21(15-13-18)26(3)32(29,30)22-11-7-8-19(16-22)24(28)31-17-23(27)25(2)20-9-5-4-6-10-20/h7-8,11-16,20H,4-6,9-10,17H2,1-3H3 |
| InChIKey | RFDJYXJOYAMEBN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |