C18H21NO6S2 — CID 55821713
3-(benzenesulfonyl)propyl 3-(ethylsulfamoyl)benzoate (PubChem CID 55821713) has the molecular formula C18H21NO6S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-(benzenesulfonyl)propyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | 3-(benzenesulfonyl)propyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55821713 |
| Molecular Formula | C18H21NO6S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-(benzenesulfonyl)propyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCCCS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO6S2/c1-2-19-27(23,24)17-11-6-8-15(14-17)18(20)25-12-7-13-26(21,22)16-9-4-3-5-10-16/h3-6,8-11,14,19H,2,7,12-13H2,1H3 |
| InChIKey | CQIGRZSZNJLXRU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|