C18H19NO6S — CID 43023400
(2-methoxy-2-oxo-1-phenylethyl) 3-(ethylsulfamoyl)benzoate (PubChem CID 43023400) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is (2-methoxy-2-oxo-1-phenylethyl) 3-(ethylsulfamoyl)benzoate.
| Compound Name | (2-methoxy-2-oxo-1-phenylethyl) 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43023400 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2-methoxy-2-oxo-1-phenylethyl) 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OC(C(=O)OC)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19NO6S/c1-3-19-26(22,23)15-11-7-10-14(12-15)17(20)25-16(18(21)24-2)13-8-5-4-6-9-13/h4-12,16,19H,3H2,1-2H3 |
| InChIKey | HCOQRUYCHWFXFR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |