C21H26N2O5S — CID 9416369
[(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 9416369) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9416369 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CCN(CC)C(=O)[C@@H](OC(=O)c1cccc(S(=O)(=O)N(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-5-23(6-2)20(24)19(16-11-8-7-9-12-16)28-21(25)17-13-10-14-18(15-17)29(26,27)22(3)4/h7-15,19H,5-6H2,1-4H3/t19-/m0/s1 |
| InChIKey | FCQWLUYKJHGYKF-IBGZPJMESA-N |
| XLogP | 2.70 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |