C19H26N3O3S+ — CID 8936150
[(2R)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8936150) has the molecular formula C19H26N3O3S+ and a molecular weight of 376.50 g/mol. Its IUPAC name is [(2R)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2R)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8936150 |
| Molecular Formula | C19H26N3O3S+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(2R)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N[C@@H](C[NH+](C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-21(2)14-18(15-9-6-5-7-10-15)20-19(23)16-11-8-12-17(13-16)26(24,25)22(3)4/h5-13,18H,14H2,1-4H3,(H,20,23)/p+1/t18-/m0/s1 |
| InChIKey | RCISVDSFJLQHEF-SFHVURJKSA-O |
| XLogP | 0.55 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |