C19H25N2O3+ — CID 8936252
[(2R)-2-[(3,4-dimethoxybenzoyl)amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8936252) has the molecular formula C19H25N2O3+ and a molecular weight of 329.42 g/mol. Its IUPAC name is [(2R)-2-[(3,4-dimethoxybenzoyl)amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2R)-2-[(3,4-dimethoxybenzoyl)amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8936252 |
| Molecular Formula | C19H25N2O3+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [(2R)-2-[(3,4-dimethoxybenzoyl)amino]-2-phenylethyl]-dimethylazanium |
| SMILES | COc1ccc(C(=O)N[C@@H](C[NH+](C)C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-21(2)13-16(14-8-6-5-7-9-14)20-19(22)15-10-11-17(23-3)18(12-15)24-4/h5-12,16H,13H2,1-4H3,(H,20,22)/p+1/t16-/m0/s1 |
| InChIKey | OZVPXTONCHIWAB-INIZCTEOSA-O |
| XLogP | 1.32 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |