C28H27N3O6S — CID 123335047
3-(pyridin-3-ylamino)propyl 2-hydroxy-4-[[3-(2-hydroxy-5-methylphenyl)phenyl]sulfonylamino]benzoate (PubChem CID 123335047) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is 3-(pyridin-3-ylamino)propyl 2-hydroxy-4-[[3-(2-hydroxy-5-methylphenyl)phenyl]sulfonylamino]benzoate.
| Compound Name | 3-(pyridin-3-ylamino)propyl 2-hydroxy-4-[[3-(2-hydroxy-5-methylphenyl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 123335047 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 3-(pyridin-3-ylamino)propyl 2-hydroxy-4-[[3-(2-hydroxy-5-methylphenyl)phenyl]sulfonylamino]benzoate |
| SMILES | Cc1ccc(O)c(-c2cccc(S(=O)(=O)Nc3ccc(C(=O)OCCCNc4cccnc4)c(O)c3)c2)c1 |
| InChI | InChI=1S/C28H27N3O6S/c1-19-8-11-26(32)25(15-19)20-5-2-7-23(16-20)38(35,36)31-21-9-10-24(27(33)17-21)28(34)37-14-4-13-30-22-6-3-12-29-18-22/h2-3,5-12,15-18,30-33H,4,13-14H2,1H3 |
| InChIKey | CBSASKNFZLBCET-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|