C24H22N4O6S — CID 55569306
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 55569306) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55569306 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)OCCCc3nc(-c4cccnc4)no3)c2)cc1 |
| InChI | InChI=1S/C24H22N4O6S/c1-32-20-11-9-19(10-12-20)28-35(30,31)21-7-2-5-17(15-21)24(29)33-14-4-8-22-26-23(27-34-22)18-6-3-13-25-16-18/h2-3,5-7,9-13,15-16,28H,4,8,14H2,1H3 |
| InChIKey | PYPABHNYMDDBND-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|