C21H19NO6S — CID 71611200
methyl 2-hydroxy-4-[[3-[2-(hydroxymethyl)phenyl]phenyl]sulfonylamino]benzoate (PubChem CID 71611200) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is methyl 2-hydroxy-4-[[3-[2-(hydroxymethyl)phenyl]phenyl]sulfonylamino]benzoate.
| Compound Name | methyl 2-hydroxy-4-[[3-[2-(hydroxymethyl)phenyl]phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 71611200 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | methyl 2-hydroxy-4-[[3-[2-(hydroxymethyl)phenyl]phenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2cccc(-c3ccccc3CO)c2)cc1O |
| InChI | InChI=1S/C21H19NO6S/c1-28-21(25)19-10-9-16(12-20(19)24)22-29(26,27)17-7-4-6-14(11-17)18-8-3-2-5-15(18)13-23/h2-12,22-24H,13H2,1H3 |
| InChIKey | XCBXQEKTZSUHGL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |