C20H18N2O4S — CID 18083751
pyridin-3-ylmethyl 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 18083751) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is pyridin-3-ylmethyl 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | pyridin-3-ylmethyl 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 18083751 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | pyridin-3-ylmethyl 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-22(18-7-3-2-4-8-18)27(24,25)19-11-9-17(10-12-19)20(23)26-15-16-6-5-13-21-14-16/h2-14H,15H2,1H3 |
| InChIKey | ZLYDNNHULOVEAY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |