C21H20N2O4S — CID 4935758
benzyl N-[4-[methyl(phenyl)sulfamoyl]phenyl]carbamate (PubChem CID 4935758) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is benzyl N-[4-[methyl(phenyl)sulfamoyl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[methyl(phenyl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 4935758 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | benzyl N-[4-[methyl(phenyl)sulfamoyl]phenyl]carbamate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-23(19-10-6-3-7-11-19)28(25,26)20-14-12-18(13-15-20)22-21(24)27-16-17-8-4-2-5-9-17/h2-15H,16H2,1H3,(H,22,24) |
| InChIKey | MSNWESCITKVYEM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |