About furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate
furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2683146) has the molecular formula C16H17NO5S
and a molecular weight of 335.38 g/mol. Its IUPAC name is furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate |
| PubChem CID | 2683146 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccco1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H17NO5S/c18-16(22-12-14-4-3-11-21-14)13-5-7-15(8-6-13)23(19,20)17-9-1-2-10-17/h3-8,11H,1-2,9-10,12H2 |
| InChIKey | ORUOCJTYSAZYHN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The IUPAC name of furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate (CID 2683146) is furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate.
What is the SMILES notation for furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The canonical SMILES for furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate is O=C(OCc1ccco1)c1ccc(S(=O)(=O)N2CCCC2)cc1.
What is the InChIKey of furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The InChIKey is ORUOCJTYSAZYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5S/c18-16(22-12-14-4-3-11-21-14)13-5-7-15(8-6-13)23(19,20)17-9-1-2-10-17/h3-8,11H,1-2,9-10,12H2.
What are the key properties of furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate?
furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate has a molecular weight of 335.38 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 4-pyrrolidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 2683146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).