C17H22N6O4S — CID 55390076
(4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 55390076) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55390076 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | Nc1nc(N)nc(COC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)n1 |
| InChI | InChI=1S/C17H22N6O4S/c18-16-20-14(21-17(19)22-16)11-27-15(24)12-5-7-13(8-6-12)28(25,26)23-9-3-1-2-4-10-23/h5-8H,1-4,9-11H2,(H4,18,19,20,21,22) |
| InChIKey | KJPONHFFNXNEJB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 154.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |