C16H17NO6S — CID 1043465
furan-2-ylmethyl 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 1043465) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is furan-2-ylmethyl 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | furan-2-ylmethyl 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 1043465 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | furan-2-ylmethyl 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccco1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H17NO6S/c18-16(23-12-14-4-2-8-22-14)13-3-1-5-15(11-13)24(19,20)17-6-9-21-10-7-17/h1-5,8,11H,6-7,9-10,12H2 |
| InChIKey | YGLDVKOHMAKTKU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |