C21H24F3N3O3S2 — CID 91593185
1-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]pyrrolidin-3-ol (PubChem CID 91593185) has the molecular formula C21H24F3N3O3S2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 1-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]pyrrolidin-3-ol.
| Compound Name | 1-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 91593185 |
| Molecular Formula | C21H24F3N3O3S2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]pyrrolidin-3-ol |
| SMILES | [H]/N=C(/C/C(=N\CCN1CCC(O)C1)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1)C(F)(F)F |
| InChI | InChI=1S/C21H24F3N3O3S2/c1-32(29,30)16-4-2-3-14(11-16)18-5-6-19(31-18)17(12-20(25)21(22,23)24)26-8-10-27-9-7-15(28)13-27/h2-6,11,15,25,28H,7-10,12-13H2,1H3/b25-20-,26-17+ |
| InChIKey | XBSLXBFJENRDDI-DEVKVPITSA-N |
| XLogP | 3.65 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|