C26H26ClN3O3S2 — CID 91383956
4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-piperidin-1-ylbutan-1-one (PubChem CID 91383956) has the molecular formula C26H26ClN3O3S2 and a molecular weight of 528.10 g/mol. Its IUPAC name is 4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 91383956 |
| Molecular Formula | C26H26ClN3O3S2 |
| Molecular Weight | 528.10 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-piperidin-1-ylbutan-1-one |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H26ClN3O3S2/c1-35(32,33)19-9-7-8-18(16-19)24-12-13-25(34-24)23(29-22-11-4-3-10-20(22)27)17-21(28)26(31)30-14-5-2-6-15-30/h3-4,7-13,16,28H,2,5-6,14-15,17H2,1H3/b28-21-,29-23+ |
| InChIKey | HTOCUZCZBOZVLM-ZIGJVRFVSA-N |
| XLogP | 6.02 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.10 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|