C28H34ClN3O2S2 — CID 90922193
N-[4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butyl]-N-methylhexan-1-amine (PubChem CID 90922193) has the molecular formula C28H34ClN3O2S2 and a molecular weight of 544.19 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butyl]-N-methylhexan-1-amine.
| Compound Name | N-[4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butyl]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 90922193 |
| Molecular Formula | C28H34ClN3O2S2 |
| Molecular Weight | 544.19 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[4-(2-chlorophenyl)imino-2-imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butyl]-N-methylhexan-1-amine |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1)CN(C)CCCCCC |
| InChI | InChI=1S/C28H34ClN3O2S2/c1-4-5-6-9-17-32(2)20-22(30)19-26(31-25-14-8-7-13-24(25)29)28-16-15-27(35-28)21-11-10-12-23(18-21)36(3,33)34/h7-8,10-16,18,30H,4-6,9,17,19-20H2,1-3H3/b30-22-,31-26+ |
| InChIKey | ZXMFMNHQOYDOAL-CLEPBEOYSA-N |
| XLogP | 7.51 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.19 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|