C25H23ClF2N2O3S — CID 90845170
5-(2-chloro-6-fluorophenyl)-5-[2-fluoro-4-(3-methylsulfonylphenyl)phenyl]imino-3-imino-2-methylpentan-2-ol (PubChem CID 90845170) has the molecular formula C25H23ClF2N2O3S and a molecular weight of 504.99 g/mol. Its IUPAC name is 5-(2-chloro-6-fluorophenyl)-5-[2-fluoro-4-(3-methylsulfonylphenyl)phenyl]imino-3-imino-2-methylpentan-2-ol.
| Compound Name | 5-(2-chloro-6-fluorophenyl)-5-[2-fluoro-4-(3-methylsulfonylphenyl)phenyl]imino-3-imino-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 90845170 |
| Molecular Formula | C25H23ClF2N2O3S |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 5-(2-chloro-6-fluorophenyl)-5-[2-fluoro-4-(3-methylsulfonylphenyl)phenyl]imino-3-imino-2-methylpentan-2-ol |
| SMILES | [H]/N=C(/C/C(=N\c1ccc(-c2cccc(S(C)(=O)=O)c2)cc1F)c1c(F)cccc1Cl)C(C)(C)O |
| InChI | InChI=1S/C25H23ClF2N2O3S/c1-25(2,31)23(29)14-22(24-18(26)8-5-9-19(24)27)30-21-11-10-16(13-20(21)28)15-6-4-7-17(12-15)34(3,32)33/h4-13,29,31H,14H2,1-3H3/b29-23-,30-22+ |
| InChIKey | ZNFQYJFVFDOSDV-JLNTUJCBSA-N |
| XLogP | 5.99 |
| TPSA | 90.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|