C28H33N3O3S2 — CID 173499512
1-[2-amino-4-(2-ethylphenyl)imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enyl]piperidin-3-ol (PubChem CID 173499512) has the molecular formula C28H33N3O3S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is 1-[2-amino-4-(2-ethylphenyl)imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enyl]piperidin-3-ol.
| Compound Name | 1-[2-amino-4-(2-ethylphenyl)imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enyl]piperidin-3-ol |
|---|---|
| PubChem CID | 173499512 |
| Molecular Formula | C28H33N3O3S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 1-[2-amino-4-(2-ethylphenyl)imino-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enyl]piperidin-3-ol |
| SMILES | CCc1ccccc1/N=C(\C=C(N)CN1CCCC(O)C1)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1 |
| InChI | InChI=1S/C28H33N3O3S2/c1-3-20-8-4-5-12-25(20)30-26(17-22(29)18-31-15-7-10-23(32)19-31)28-14-13-27(35-28)21-9-6-11-24(16-21)36(2,33)34/h4-6,8-9,11-14,16-17,23,32H,3,7,10,15,18-19,29H2,1-2H3/b22-17?,30-26+ |
| InChIKey | BAGFIPKHDWKITC-RCIDZVTOSA-N |
| XLogP | 4.80 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|