C24H25ClN3O2S2- — CID 173499557
3-[5-[C-[2-amino-3-(diethylamino)prop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]thiophen-2-yl]benzenesulfinate (PubChem CID 173499557) has the molecular formula C24H25ClN3O2S2- and a molecular weight of 487.07 g/mol. Its IUPAC name is 3-[5-[C-[2-amino-3-(diethylamino)prop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]thiophen-2-yl]benzenesulfinate.
| Compound Name | 3-[5-[C-[2-amino-3-(diethylamino)prop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]thiophen-2-yl]benzenesulfinate |
|---|---|
| PubChem CID | 173499557 |
| Molecular Formula | C24H25ClN3O2S2- |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 3-[5-[C-[2-amino-3-(diethylamino)prop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]thiophen-2-yl]benzenesulfinate |
| SMILES | CCN(CC)CC(N)=C/C(=N\c1ccccc1Cl)c1ccc(-c2cccc(S(=O)[O-])c2)s1 |
| InChI | InChI=1S/C24H26ClN3O2S2/c1-3-28(4-2)16-18(26)15-22(27-21-11-6-5-10-20(21)25)24-13-12-23(31-24)17-8-7-9-19(14-17)32(29)30/h5-15H,3-4,16,26H2,1-2H3,(H,29,30)/p-1/b18-15?,27-22+ |
| InChIKey | NHPORNJNRWLKKL-HSXHCGONSA-M |
| XLogP | 5.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|