C22H20ClFN2OS — CID 173499578
3-amino-5-(2-chlorophenyl)imino-5-[5-(3-fluorophenyl)thiophen-2-yl]-2-methylpent-3-en-2-ol (PubChem CID 173499578) has the molecular formula C22H20ClFN2OS and a molecular weight of 414.93 g/mol. Its IUPAC name is 3-amino-5-(2-chlorophenyl)imino-5-[5-(3-fluorophenyl)thiophen-2-yl]-2-methylpent-3-en-2-ol.
| Compound Name | 3-amino-5-(2-chlorophenyl)imino-5-[5-(3-fluorophenyl)thiophen-2-yl]-2-methylpent-3-en-2-ol |
|---|---|
| PubChem CID | 173499578 |
| Molecular Formula | C22H20ClFN2OS |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-amino-5-(2-chlorophenyl)imino-5-[5-(3-fluorophenyl)thiophen-2-yl]-2-methylpent-3-en-2-ol |
| SMILES | CC(C)(O)C(N)=C/C(=N\c1ccccc1Cl)c1ccc(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C22H20ClFN2OS/c1-22(2,27)21(25)13-18(26-17-9-4-3-8-16(17)23)20-11-10-19(28-20)14-6-5-7-15(24)12-14/h3-13,27H,25H2,1-2H3/b21-13?,26-18+ |
| InChIKey | WRARDXYFKXNFGM-ZVAUQBGFSA-N |
| XLogP | 5.94 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|