C23H17ClF3N3O2 — CID 90803549
4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]-N-(2-hydroxyphenyl)benzamide (PubChem CID 90803549) has the molecular formula C23H17ClF3N3O2 and a molecular weight of 459.86 g/mol. Its IUPAC name is 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 90803549 |
| Molecular Formula | C23H17ClF3N3O2 |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]-N-(2-hydroxyphenyl)benzamide |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(C(=O)Nc2ccccc2O)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H17ClF3N3O2/c24-16-5-1-2-6-17(16)29-19(13-21(28)23(25,26)27)14-9-11-15(12-10-14)22(32)30-18-7-3-4-8-20(18)31/h1-12,28,31H,13H2,(H,30,32)/b28-21-,29-19+ |
| InChIKey | KGIRXYYEZLCNCP-JOSPPYABSA-N |
| XLogP | 6.39 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|