C24H18F6N2O2S — CID 59632878
(Z)-1,1,1-trifluoro-4-[4-(3-methylsulfonylphenyl)phenyl]imino-4-[2-(trifluoromethyl)phenyl]but-2-en-2-amine (PubChem CID 59632878) has the molecular formula C24H18F6N2O2S and a molecular weight of 512.48 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-[4-(3-methylsulfonylphenyl)phenyl]imino-4-[2-(trifluoromethyl)phenyl]but-2-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-4-[4-(3-methylsulfonylphenyl)phenyl]imino-4-[2-(trifluoromethyl)phenyl]but-2-en-2-amine |
|---|---|
| PubChem CID | 59632878 |
| Molecular Formula | C24H18F6N2O2S |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-[4-(3-methylsulfonylphenyl)phenyl]imino-4-[2-(trifluoromethyl)phenyl]but-2-en-2-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(/N=C(\C=C(/N)C(F)(F)F)c3ccccc3C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H18F6N2O2S/c1-35(33,34)18-6-4-5-16(13-18)15-9-11-17(12-10-15)32-21(14-22(31)24(28,29)30)19-7-2-3-8-20(19)23(25,26)27/h2-14H,31H2,1H3/b22-14-,32-21+ |
| InChIKey | NEAXQIAYMBBPOZ-DJUNRKQVSA-N |
| XLogP | 6.30 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|