C26H25F3N2O4S2 — CID 59632679
[2-[[(Z)-3-amino-4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enylidene]amino]phenyl] 2,2-dimethylpropanoate (PubChem CID 59632679) has the molecular formula C26H25F3N2O4S2 and a molecular weight of 550.62 g/mol. Its IUPAC name is [2-[[(Z)-3-amino-4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enylidene]amino]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[(Z)-3-amino-4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enylidene]amino]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59632679 |
| Molecular Formula | C26H25F3N2O4S2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [2-[[(Z)-3-amino-4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)thiophen-2-yl]but-2-enylidene]amino]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccccc1/N=C(\C=C(/N)C(F)(F)F)c1cc(-c2cccc(S(C)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C26H25F3N2O4S2/c1-25(2,3)24(32)35-21-11-6-5-10-19(21)31-20(14-23(30)26(27,28)29)22-13-17(15-36-22)16-8-7-9-18(12-16)37(4,33)34/h5-15H,30H2,1-4H3/b23-14-,31-20+ |
| InChIKey | RWSSEIKRMRHEKI-XAVMQQOESA-N |
| XLogP | 6.30 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|