C25H21F3N2O4S2 — CID 68655522
[2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenyl] 2-methylpropanoate (PubChem CID 68655522) has the molecular formula C25H21F3N2O4S2 and a molecular weight of 534.58 g/mol. Its IUPAC name is [2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenyl] 2-methylpropanoate.
| Compound Name | [2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 68655522 |
| Molecular Formula | C25H21F3N2O4S2 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccccc1-n1nc(C(F)(F)F)cc1-c1cc(-c2cccc(S(C)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C25H21F3N2O4S2/c1-15(2)24(31)34-21-10-5-4-9-19(21)30-20(13-23(29-30)25(26,27)28)22-12-17(14-35-22)16-7-6-8-18(11-16)36(3,32)33/h4-15H,1-3H3 |
| InChIKey | GMDBYGCDSQBESH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|