C24H20ClF3N2O3S2 — CID 59633455
1-[2-(3-chloropropoxy)phenyl]-5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole (PubChem CID 59633455) has the molecular formula C24H20ClF3N2O3S2 and a molecular weight of 541.02 g/mol. Its IUPAC name is 1-[2-(3-chloropropoxy)phenyl]-5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[2-(3-chloropropoxy)phenyl]-5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 59633455 |
| Molecular Formula | C24H20ClF3N2O3S2 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 1-[2-(3-chloropropoxy)phenyl]-5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
| SMILES | CS(=O)(=O)c1cccc(-c2csc(-c3cc(C(F)(F)F)nn3-c3ccccc3OCCCCl)c2)c1 |
| InChI | InChI=1S/C24H20ClF3N2O3S2/c1-35(31,32)18-7-4-6-16(12-18)17-13-22(34-15-17)20-14-23(24(26,27)28)29-30(20)19-8-2-3-9-21(19)33-11-5-10-25/h2-4,6-9,12-15H,5,10-11H2,1H3 |
| InChIKey | AKHOCKACIOKEEF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|