C27H25F3N2O4S2 — CID 59633382
6-[2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenoxy]hexan-2-one (PubChem CID 59633382) has the molecular formula C27H25F3N2O4S2 and a molecular weight of 562.64 g/mol. Its IUPAC name is 6-[2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenoxy]hexan-2-one.
| Compound Name | 6-[2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenoxy]hexan-2-one |
|---|---|
| PubChem CID | 59633382 |
| Molecular Formula | C27H25F3N2O4S2 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 6-[2-[5-[4-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazol-1-yl]phenoxy]hexan-2-one |
| SMILES | CC(=O)CCCCOc1ccccc1-n1nc(C(F)(F)F)cc1-c1cc(-c2cccc(S(C)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C27H25F3N2O4S2/c1-18(33)8-5-6-13-36-24-12-4-3-11-22(24)32-23(16-26(31-32)27(28,29)30)25-15-20(17-37-25)19-9-7-10-21(14-19)38(2,34)35/h3-4,7,9-12,14-17H,5-6,8,13H2,1-2H3 |
| InChIKey | DRJBXJQZLCGZGB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|