C20H15F3N4O4S2 — CID 137483778
[5-[5-(3-methylsulfonylphenyl)-1,3,4-thiadiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazol-3-yl]methanediol (PubChem CID 137483778) has the molecular formula C20H15F3N4O4S2 and a molecular weight of 496.49 g/mol. Its IUPAC name is [5-[5-(3-methylsulfonylphenyl)-1,3,4-thiadiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazol-3-yl]methanediol.
| Compound Name | [5-[5-(3-methylsulfonylphenyl)-1,3,4-thiadiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazol-3-yl]methanediol |
|---|---|
| PubChem CID | 137483778 |
| Molecular Formula | C20H15F3N4O4S2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | [5-[5-(3-methylsulfonylphenyl)-1,3,4-thiadiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazol-3-yl]methanediol |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(-c3cc(C(O)O)nn3-c3ccccc3C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C20H15F3N4O4S2/c1-33(30,31)12-6-4-5-11(9-12)17-24-25-18(32-17)16-10-14(19(28)29)26-27(16)15-8-3-2-7-13(15)20(21,22)23/h2-10,19,28-29H,1H3 |
| InChIKey | AIDBYHPMAXWXCW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|